ChemNet > CAS > 226717-83-5 2,3,5-trifluorobenzyl bromide
226717-83-5 2,3,5-trifluorobenzyl bromide
| اسم المنتج |
2,3,5-trifluorobenzyl bromide |
| الاسم المستعار |
alpha-Bromo-2,3,5-trifluorotoluene; 1-(bromomethyl)-2,3,5-trifluorobenzene |
| الصيغة الجزيئية |
C7H4BrF3 |
| الوزن الجزيئي الغرامي |
225.0059 |
| InChI |
InChI=1/C7H4BrF3/c8-3-4-1-5(9)2-6(10)7(4)11/h1-2H,3H2 |
| إستراتيجية المساعدة القطرية |
226717-83-5 |
| بنية جزيئية |
|
| كثافة |
1.71g/cm3 |
| نقطة الغليان |
181.1°C at 760 mmHg |
| معامل الإنكسار |
1.502 |
| نقطة الوميض |
69.1°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
